EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | NOOLISFMXDJSKH-AEJSXWLSSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-menthol (CHEBI:76306) is a p-menthan-3-ol (CHEBI:25187) |
| (+)-menthol (CHEBI:76306) is enantiomer of (−)-menthol (CHEBI:15409) |
| Incoming Relation(s) |
| (±)-menthol (CHEBI:76310) has part (+)-menthol (CHEBI:76306) |
| (−)-menthol (CHEBI:15409) is enantiomer of (+)-menthol (CHEBI:76306) |
| IUPAC Name |
|---|
| (1S,2R,5S)-2-isopropyl-5-methylcyclohexanol |
| Synonyms | Source |
|---|---|
| (+)-(1S,3S,4R)-menthol | ChEBI |
| d-menthol | ChemIDplus |
| (+)-(1S,2R,5S)-menthol | ChEBI |
| (1S,2R,5S)-(+)-menthol | ChemIDplus |
| (1S,2R,5S)-menthol | ChemIDplus |
| D-menthol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1902292 | Reaxys |
| CAS:15356-60-2 | ChemIDplus |
| Citations |
|---|