EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | NOOLISFMXDJSKH-OPRDCNLKSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neoisomenthol (CHEBI:18451) is a p-menthan-3-ol (CHEBI:25187) |
| IUPAC Name |
|---|
| rel-(1R,2R,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol |
| Synonyms | Source |
|---|---|
| (1α,2α,5α)-5-methyl-2-(1-methylethyl)cyclohexanol | NIST Chemistry WebBook |
| cis-1,3,cis-1,4-menthol | NIST Chemistry WebBook |
| iso-neomenthol | NIST Chemistry WebBook |