EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | NOOLISFMXDJSKH-UTLUCORTSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-neomenthol (CHEBI:15402) is a p-menthan-3-ol (CHEBI:25187) |
| Incoming Relation(s) |
| (+)-neomenthyl β-D-glucoside (CHEBI:27934) has functional parent (+)-neomenthol (CHEBI:15402) |
| IUPAC Name |
|---|
| (1S,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol |
| Synonym | Source |
|---|---|
| (+)-Neomenthol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (+)-neomenthol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00553 | KEGG COMPOUND |
| C00553 | KEGG COMPOUND |
| LMPR0102090003 | LIPID MAPS |
| C00000825 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:2216-52-6 | KEGG COMPOUND |