EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
| InChIKey | RZVAJINKPMORJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase 3 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 3. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paracetamol (CHEBI:46195) has functional parent 4-aminophenol (CHEBI:17602) |
| paracetamol (CHEBI:46195) has role antipyretic (CHEBI:35493) |
| paracetamol (CHEBI:46195) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| paracetamol (CHEBI:46195) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| paracetamol (CHEBI:46195) has role cyclooxygenase 3 inhibitor (CHEBI:73263) |
| paracetamol (CHEBI:46195) has role environmental contaminant (CHEBI:78298) |
| paracetamol (CHEBI:46195) has role ferroptosis inducer (CHEBI:173085) |
| paracetamol (CHEBI:46195) has role geroprotector (CHEBI:176497) |
| paracetamol (CHEBI:46195) has role hepatotoxic agent (CHEBI:50908) |
| paracetamol (CHEBI:46195) has role human blood serum metabolite (CHEBI:85234) |
| paracetamol (CHEBI:46195) has role non-narcotic analgesic (CHEBI:35481) |
| paracetamol (CHEBI:46195) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| paracetamol (CHEBI:46195) has role xenobiotic (CHEBI:35703) |
| paracetamol (CHEBI:46195) is a acetamides (CHEBI:22160) |
| paracetamol (CHEBI:46195) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) has functional parent paracetamol (CHEBI:46195) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) has functional parent paracetamol (CHEBI:46195) |
| 2-methoxyacetaminophen glucuronide (CHEBI:133005) has functional parent paracetamol (CHEBI:46195) |
| 3-nitroacetaminophen (CHEBI:139475) has functional parent paracetamol (CHEBI:46195) |
| 3-nitroacetaminophen-TMS (CHEBI:139476) has functional parent paracetamol (CHEBI:46195) |
| acetaminophen O-β-D-glucosiduronic acid (CHEBI:32636) has functional parent paracetamol (CHEBI:46195) |
| acetaminophen glutathione conjugate (CHEBI:32639) has functional parent paracetamol (CHEBI:46195) |
| methacetin (CHEBI:139354) has functional parent paracetamol (CHEBI:46195) |
| paracetamol sulfate (CHEBI:32635) has functional parent paracetamol (CHEBI:46195) |
| phenacetin (CHEBI:8050) has functional parent paracetamol (CHEBI:46195) |
| IUPAC Name |
|---|
| N-(4-hydroxyphenyl)acetamide |
| INNs | Source |
|---|---|
| paracetamol | KEGG DRUG |
| paracetamol | WHO MedNet |
| paracétamol | WHO MedNet |
| paracetamolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-acetamidophenol | NIST Chemistry WebBook |
| 4-(Acetylamino)phenol | ChemIDplus |
| 4'-hydroxyacetanilide | ChemIDplus |
| Acenol | ChemIDplus |
| Acetaminofen | ChemIDplus |
| acetaminofén | ChemIDplus |
| Brand Names | Source |
|---|---|
| Panadol | ChEBI |
| Tylenol | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| 4-acetamidophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1906 | ChemSpider |
| 52 | DrugCentral |
| Acetaminophen | Wikipedia |
| C06804 | KEGG COMPOUND |
| CPD-7669 | MetaCyc |
| D00217 | KEGG DRUG |
| DB00316 | DrugBank |
| HMDB0001859 | HMDB |
| LSM-5533 | LINCS |
| TYL | PDBeChem |
| Citations |
|---|