EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | CCOc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12) |
| InChIKey | CPJSUEIXXCENMM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 3 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 3. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenacetin (CHEBI:8050) has functional parent N-phenylacetamide (CHEBI:28884) |
| phenacetin (CHEBI:8050) has functional parent 4-ethoxyaniline (CHEBI:85505) |
| phenacetin (CHEBI:8050) has functional parent paracetamol (CHEBI:46195) |
| phenacetin (CHEBI:8050) has role cyclooxygenase 3 inhibitor (CHEBI:73263) |
| phenacetin (CHEBI:8050) has role non-narcotic analgesic (CHEBI:35481) |
| phenacetin (CHEBI:8050) has role peripheral nervous system drug (CHEBI:49110) |
| phenacetin (CHEBI:8050) is a acetamides (CHEBI:22160) |
| phenacetin (CHEBI:8050) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| N-(4-ethoxyphenyl)acetamide |
| INNs | Source |
|---|---|
| Fenacetina | ChemIDplus |
| phenacetin | ChEBI |
| Phenacetine | ChemIDplus |
| Phenacetinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Acetamido-4-ethoxybenzene | ChemIDplus |
| 4-Ethoxyacetanilide | ChemIDplus |
| Acetophenetidin | KEGG COMPOUND |
| Acetophenetidine | DrugBank |
| Acetophenetin | DrugBank |
| Acetphenetidin | DrugBank |
| Brand Names | Source |
|---|---|
| Achrocidin | DrugBank |
| Codempiral | DrugBank |
| Commotional | DrugBank |
| Contradol | DrugBank |
| Contradouleur | DrugBank |
| UniProt Name | Source |
|---|---|
| N-(4-ethoxyphenyl)acetamide | UniProt |
| Citations |
|---|