EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO |
| Net Charge | 0 |
| Average Mass | 109.128 |
| Monoisotopic Mass | 109.05276 |
| SMILES | Nc1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2 |
| InChIKey | PLIKAWJENQZMHA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminophenol (CHEBI:17602) has role allergen (CHEBI:50904) |
| 4-aminophenol (CHEBI:17602) has role metabolite (CHEBI:25212) |
| 4-aminophenol (CHEBI:17602) is a aminophenol (CHEBI:28829) |
| Incoming Relation(s) |
| 4-methylaminophenol (CHEBI:55416) has functional parent 4-aminophenol (CHEBI:17602) |
| aminoparathion (CHEBI:28055) has functional parent 4-aminophenol (CHEBI:17602) |
| paracetamol (CHEBI:46195) has functional parent 4-aminophenol (CHEBI:17602) |
| IUPAC Name |
|---|
| 4-aminophenol |
| Synonyms | Source |
|---|---|
| 4-Aminobenzenol | KEGG COMPOUND |
| 4-Aminophenol | KEGG COMPOUND |
| 4-AMINOPHENOL | PDBeChem |
| 4-Hydroxyaniline | KEGG COMPOUND |
| p-hydroxyaniline | NIST Chemistry WebBook |
| p-Aminophenol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-aminophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-Aminophenol | Wikipedia |
| 4NL | PDBeChem |
| c0090 | UM-BBD |
| C02372 | KEGG COMPOUND |
| C02372 | KEGG COMPOUND |
| CPD-259 | MetaCyc |
| HMDB0001169 | HMDB |
| Citations |
|---|