EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O5S |
| Net Charge | 0 |
| Average Mass | 312.347 |
| Monoisotopic Mass | 312.07799 |
| SMILES | CC(=O)Nc1ccc(O)c(SC[C@H](NC(C)=O)C(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O5S/c1-7(16)14-9-3-4-11(18)12(5-9)21-6-10(13(19)20)15-8(2)17/h3-5,10,18H,6H2,1-2H3,(H,14,16)(H,15,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | DVPRQNKJGQEICH-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (6833497) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2087153) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) has functional parent paracetamol (CHEBI:46195) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) has role drug metabolite (CHEBI:49103) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) has role human urinary metabolite (CHEBI:84087) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) has role rat metabolite (CHEBI:86264) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) is a S-substituted N-acetyl-L-cysteine (CHEBI:47911) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) is a acetamides (CHEBI:22160) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) is a organic sulfide (CHEBI:16385) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) is a phenols (CHEBI:33853) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) is conjugate acid of S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteinate (CHEBI:133438) |
| Incoming Relation(s) |
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteinate (CHEBI:133438) is conjugate base of S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine (CHEBI:133435) |
| IUPAC Name |
|---|
| S-(5-acetamido-2-hydroxyphenyl)-N-acetyl-L-cysteine |
| Synonyms | Source |
|---|---|
| acetaminophen N-acetyl-L-cysteine conjugate | ChEBI |
| paracetamol N-acetyl-L-cysteine conjugate | ChEBI |
| N-acetyl-L-cysteine S-acetaminophen conjugate | ChEBI |
| 3-(N-acetyl-L-cystein-S-yl)acetaminophen | ChEBI |
| N-acetyl-L-cysteine S-paracetamol conjugate | ChEBI |
| Acetaminophen mercapturate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395991 | Reaxys |
| CAS:52372-86-8 | ChemIDplus |
| Citations |
|---|