EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4S |
| Net Charge | 0 |
| Average Mass | 270.310 |
| Monoisotopic Mass | 270.06743 |
| SMILES | CC(=O)Nc1ccc(O)c(SCC(N)C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O4S/c1-6(14)13-7-2-3-9(15)10(4-7)18-5-8(12)11(16)17/h2-4,8,15H,5,12H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | LLHICPSCVFRWDT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (1992763) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) has functional parent paracetamol (CHEBI:46195) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) has role human xenobiotic metabolite (CHEBI:76967) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) is a acetamides (CHEBI:22160) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) is a cysteine derivative (CHEBI:23509) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) is a organic sulfide (CHEBI:16385) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) is a phenols (CHEBI:33853) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) is tautomer of S-(5-acetamido-2-hydroxyphenyl)cysteine zwitterion (CHEBI:133067) |
| Incoming Relation(s) |
| S-(5-acetamido-2-hydroxyphenyl)cysteine zwitterion (CHEBI:133067) is tautomer of S-(5-acetamido-2-hydroxyphenyl)cysteine (CHEBI:133066) |
| IUPAC Name |
|---|
| S-(5-acetamido-2-hydroxyphenyl)cysteine |
| Synonyms | Source |
|---|---|
| 3-(cystein-S-yl)acetaminophen | ChEBI |
| paracetamol cysteine conjugate | ChEBI |
| S-(5-acetamido-2-hydroxyphenyl)cysteine | ChEBI |
| cysteine S-acetaminophen conjugate | ChEBI |
| cysteine S-paracetamol conjugate | ChEBI |
| 3-(cystein-S-yl)paracetamol | ChEBI |
| Citations |
|---|