EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@H](O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10-/m1/s1 |
| InChIKey | BAVONGHXFVOKBV-NXEZZACHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| IUPAC Names |
|---|
| (1R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| (4R,6R)-p-mentha-1,8-dien-6-ol |
| Synonym | Source |
|---|---|
| (−)-(4R,6R)-cis-carveol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11395 | KEGG COMPOUND |
| LMPR0102090030 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042973 | Reaxys |
| CAS:2102-59-2 | KEGG COMPOUND |