EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@@H](O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10+/m1/s1 |
| InChIKey | BAVONGHXFVOKBV-ZJUUUORDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-trans-carveol (CHEBI:15389) has role human metabolite (CHEBI:77746) |
| (−)-trans-carveol (CHEBI:15389) is a carveol (CHEBI:23046) |
| (−)-trans-carveol (CHEBI:15389) is enantiomer of (+)-trans-carveol (CHEBI:15388) |
| Incoming Relation(s) |
| (+)-trans-carveol (CHEBI:15388) is enantiomer of (−)-trans-carveol (CHEBI:15389) |
| IUPAC Names |
|---|
| (1S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| (4R,6S)-p-mentha-1,8-dien-6-ol |
| Synonyms | Source |
|---|---|
| (−)-(4R,6S)-trans-carveol | ChEBI |
| (-)-trans-Carveol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,5R)-carveol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000814 | KNApSAcK |
| C00964 | KEGG COMPOUND |
| c0628 | UM-BBD |
| LMPR0102090005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2206715 | Beilstein |
| CAS:2102-58-1 | ChemIDplus |