EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@H]1CC=C(C)[C@@H](O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10-/m0/s1 |
| InChIKey | BAVONGHXFVOKBV-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| IUPAC Names |
|---|
| (1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| (4S,6S)-p-mentha-1,8-dien-6-ol |
| Synonyms | Source |
|---|---|
| (+)-(4S,6S)-cis-carveol | ChEBI |
| (4S,6S)-cis-Carveol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (1S,5S)-carveol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11408 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206716 | Reaxys |