EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | [H]C(C=C)=C(O)C(=O)O |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8) |
| InChIKey | VHTQQDXPNUTMNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) has functional parent penta-2,4-dienoic acid (CHEBI:35964) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is conjugate acid of 2-hydroxypenta-2,4-dienoate (CHEBI:37319) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is tautomer of 2-oxopent-4-enoic acid (CHEBI:37318) |
| Incoming Relation(s) |
| (2Z)-2-hydroxypenta-2,4-dienoic acid (CHEBI:48643) is a 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) is a 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| 2-hydroxypenta-2,4-dienoate (CHEBI:37319) is conjugate base of 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| 2-oxopent-4-enoic acid (CHEBI:37318) is tautomer of 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| IUPAC Name |
|---|
| 2-hydroxypenta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2,4-pentadienoic acid | ChEBI |
| HPD | ChEBI |
| Citations |
|---|