EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O2 |
| Net Charge | 0 |
| Average Mass | 98.101 |
| Monoisotopic Mass | 98.03678 |
| SMILES | [H]C(C=C)=CC(=O)O |
| InChI | InChI=1S/C5H6O2/c1-2-3-4-5(6)7/h2-4H,1H2,(H,6,7) |
| InChIKey | SDVVLIIVFBKBMG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penta-2,4-dienoic acid (CHEBI:35964) is a pentadienoic acid (CHEBI:25876) |
| penta-2,4-dienoic acid (CHEBI:35964) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| penta-2,4-dienoic acid (CHEBI:35964) is conjugate acid of penta-2,4-dienoate (CHEBI:37322) |
| Incoming Relation(s) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) has functional parent penta-2,4-dienoic acid (CHEBI:35964) |
| (E)-penta-2,4-dienoic acid (CHEBI:37331) is a penta-2,4-dienoic acid (CHEBI:35964) |
| penta-2,4-dienoate (CHEBI:37322) is conjugate base of penta-2,4-dienoic acid (CHEBI:35964) |
| IUPAC Name |
|---|
| penta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| 1,3-butadiene-1-carboxylic acids | ChEBI |
| 2,4-pentadienoic acid | ChEBI |
| but-1,3-diene-1-carboxylic acids | ChEBI |
| but-1,3-diene-1-carboxylic acid | ChEBI |
| 1,3-butadiene-1-carboxylic acid | ChEBI |
| penta-2,4-dienoic acids | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:626-99-3 | ChemIDplus |