EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C=C/C=C(/O)C(=O)O |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8)/b4-3+ |
| InChIKey | VHTQQDXPNUTMNB-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) is a 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) is conjugate acid of (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) |
| Incoming Relation(s) |
| (2E)-2-hydroxypenta-2,4-dienoate (CHEBI:60886) is conjugate base of cis-2-hydroxypenta-2,4-dienoic acid (CHEBI:1113) |
| IUPAC Name |
|---|
| (2E)-2-hydroxypenta-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| cis-2-Hydroxypenta-2,4-dienoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00596 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10772855 | Beilstein |
| Reaxys:11016640 | Reaxys |
| CAS:159694-16-3 | KEGG COMPOUND |