EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C=CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2H,1,3H2,(H,7,8) |
| InChIKey | NOXRYJAWRSNUJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxopent-4-enoic acid (CHEBI:37318) has functional parent pent-4-enoic acid (CHEBI:35936) |
| 2-oxopent-4-enoic acid (CHEBI:37318) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxopent-4-enoic acid (CHEBI:37318) is conjugate acid of 2-oxopent-4-enoate (CHEBI:11641) |
| 2-oxopent-4-enoic acid (CHEBI:37318) is tautomer of 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| Incoming Relation(s) |
| 2-oxopent-4-enoate (CHEBI:11641) is conjugate base of 2-oxopent-4-enoic acid (CHEBI:37318) |
| 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) is tautomer of 2-oxopent-4-enoic acid (CHEBI:37318) |
| IUPAC Name |
|---|
| 2-oxopent-4-enoic acid |
| Synonyms | Source |
|---|---|
| 2-keto-4-pentenoic acid | ChemIDplus |
| 2-oxo-4-pentenoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1851398 | Beilstein |
| CAS:20406-62-6 | ChemIDplus |