EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | C=C/C=C(\O)C(=O)O |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8)/b4-3- |
| InChIKey | VHTQQDXPNUTMNB-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-2-hydroxypenta-2,4-dienoic acid (CHEBI:48643) is a 2-hydroxypenta-2,4-dienoic acid (CHEBI:18355) |
| (2Z)-2-hydroxypenta-2,4-dienoic acid (CHEBI:48643) is conjugate acid of (2Z)-2-hydroxypenta-2,4-dienoate (CHEBI:67152) |
| Incoming Relation(s) |
| (2Z)-2-hydroxypenta-2,4-dienoate (CHEBI:67152) is conjugate base of (2Z)-2-hydroxypenta-2,4-dienoic acid (CHEBI:48643) |
| IUPAC Name |
|---|
| (2Z)-2-hydroxypenta-2,4-dienoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6591291 | Beilstein |