EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | OUYCCCASQSFEME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrosine (CHEBI:18186) has functional parent propionic acid (CHEBI:30768) |
| tyrosine (CHEBI:18186) has part 4-hydroxybenzyl group (CHEBI:50336) |
| tyrosine (CHEBI:18186) has role Daphnia magna metabolite (CHEBI:83056) |
| tyrosine (CHEBI:18186) is a aromatic amino acid (CHEBI:33856) |
| tyrosine (CHEBI:18186) is a polar amino acid (CHEBI:26167) |
| tyrosine (CHEBI:18186) is a α-amino acid (CHEBI:33704) |
| tyrosine (CHEBI:18186) is conjugate acid of tyrosinate(1−) (CHEBI:32784) |
| tyrosine (CHEBI:18186) is conjugate base of tyrosinium (CHEBI:32786) |
| Incoming Relation(s) |
| N-acetyltyrosine (CHEBI:68561) has functional parent tyrosine (CHEBI:18186) |
| O-methyltyrosine (CHEBI:192376) has functional parent tyrosine (CHEBI:18186) |
| 3-fluorotyrosine (CHEBI:32771) has functional parent tyrosine (CHEBI:18186) |
| 3,5-diiodotyrosyl-3,5-diiodotyrosine (CHEBI:60990) has functional parent tyrosine (CHEBI:18186) |
| tyrosine derivative (CHEBI:62761) has functional parent tyrosine (CHEBI:18186) |
| tyrosinyl radical (CHEBI:32783) has functional parent tyrosine (CHEBI:18186) |
| tyrosinyl radical cation (CHEBI:32787) has functional parent tyrosine (CHEBI:18186) |
| tyrosyltyrosine (CHEBI:60987) has functional parent tyrosine (CHEBI:18186) |
| D-tyrosine (CHEBI:28479) is a tyrosine (CHEBI:18186) |
| L-tyrosine (CHEBI:17895) is a tyrosine (CHEBI:18186) |
| tyrosinium (CHEBI:32786) is conjugate acid of tyrosine (CHEBI:18186) |
| tyrosinate(1−) (CHEBI:32784) is conjugate base of tyrosine (CHEBI:18186) |
| tyrosin-O4-yl group (CHEBI:32788) is substituent group from tyrosine (CHEBI:18186) |
| tyrosine residue (CHEBI:32789) is substituent group from tyrosine (CHEBI:18186) |
| tyrosino group (CHEBI:27178) is substituent group from tyrosine (CHEBI:18186) |
| tyrosyl group (CHEBI:37898) is substituent group from tyrosine (CHEBI:18186) |
| IUPAC Name |
|---|
| tyrosine |
| Synonyms | Source |
|---|---|
| 2-amino-3-(4-hydroxyphenyl)propanoic acid | IUPAC |
| 2-Amino-3-(p-hydroxyphenyl)propionic acid | KEGG COMPOUND |
| 3-(p-Hydroxyphenyl)alanine | KEGG COMPOUND |
| tirosina | ChEBI |
| Tyr | ChEBI |
| Tyrosin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:27744 | Gmelin |
| Reaxys:515881 | Reaxys |
| CAS:55520-40-6 | ChemIDplus |
| CAS:556-03-6 | KEGG COMPOUND |
| Citations |
|---|