EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | N[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | OUYCCCASQSFEME-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (15292242) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tyrosine (CHEBI:28479) has role Escherichia coli metabolite (CHEBI:76971) |
| D-tyrosine (CHEBI:28479) is a D-α-amino acid (CHEBI:16733) |
| D-tyrosine (CHEBI:28479) is a tyrosine (CHEBI:18186) |
| D-tyrosine (CHEBI:28479) is conjugate acid of D-tyrosinate(1−) (CHEBI:32773) |
| D-tyrosine (CHEBI:28479) is conjugate base of D-tyrosinium (CHEBI:32775) |
| D-tyrosine (CHEBI:28479) is enantiomer of L-tyrosine (CHEBI:17895) |
| D-tyrosine (CHEBI:28479) is tautomer of D-tyrosine zwitterion (CHEBI:58570) |
| Incoming Relation(s) |
| D-tyrosine derivative (CHEBI:84124) has functional parent D-tyrosine (CHEBI:28479) |
| D-tyrosinyl radical (CHEBI:32777) has functional parent D-tyrosine (CHEBI:28479) |
| D-tyrosinyl radical cation (CHEBI:32776) has functional parent D-tyrosine (CHEBI:28479) |
| D-tyrosinium (CHEBI:32775) is conjugate acid of D-tyrosine (CHEBI:28479) |
| D-tyrosinate(1−) (CHEBI:32773) is conjugate base of D-tyrosine (CHEBI:28479) |
| L-tyrosine (CHEBI:17895) is enantiomer of D-tyrosine (CHEBI:28479) |
| D-tyrosin-O4-yl group (CHEBI:32780) is substituent group from D-tyrosine (CHEBI:28479) |
| D-tyrosine residue (CHEBI:29976) is substituent group from D-tyrosine (CHEBI:28479) |
| D-tyrosino group (CHEBI:32779) is substituent group from D-tyrosine (CHEBI:28479) |
| D-tyrosyl group (CHEBI:32778) is substituent group from D-tyrosine (CHEBI:28479) |
| D-tyrosine zwitterion (CHEBI:58570) is tautomer of D-tyrosine (CHEBI:28479) |
| IUPAC Name |
|---|
| D-tyrosine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(4-hydroxyphenyl)propanoic acid | IUPAC |
| DTY | PDBeChem |
| D-Tyrosine | KEGG COMPOUND |
| D-TYROSINE | PDBeChem |
| (R)-2-Amino-3-(p-hydroxyphenyl)propionic acid | KEGG COMPOUND |
| (R)-3-(p-Hydroxyphenyl)alanine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06420 | KEGG COMPOUND |
| C06420 | KEGG COMPOUND |
| DB03839 | DrugBank |
| DTY | PDBeChem |
| D-TYROSINE | MetaCyc |
| ECMDB21520 | ECMDB |
| YMDB00805 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212157 | Reaxys |
| Gmelin:603524 | Gmelin |
| CAS:556-02-5 | KEGG COMPOUND |
| CAS:556-02-5 | ChemIDplus |
| Citations |
|---|