EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FNO3 |
| Net Charge | 0 |
| Average Mass | 199.181 |
| Monoisotopic Mass | 199.06447 |
| SMILES | NC(Cc1ccc(O)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| InChIKey | VIIAUOZUUGXERI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fluorotyrosine (CHEBI:32771) has functional parent tyrosine (CHEBI:18186) |
| 3-fluorotyrosine (CHEBI:32771) is a fluoroamino acid (CHEBI:24068) |
| 3-fluorotyrosine (CHEBI:32771) is a fluorophenol (CHEBI:142486) |
| 3-fluorotyrosine (CHEBI:32771) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 3-fluorotyrosine (CHEBI:32771) is a tyrosine derivative (CHEBI:62761) |
| Incoming Relation(s) |
| 3-fluoro-L-tyrosine (CHEBI:46534) is a 3-fluorotyrosine (CHEBI:32771) |
| IUPAC Name |
|---|
| 3-fluorotyrosine |
| Synonym | Source |
|---|---|
| 2-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2115333 | Beilstein |
| Beilstein:3204804 | Beilstein |
| CAS:403-90-7 | ChemIDplus |