EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | +1 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07334 |
| SMILES | NC(Cc1ccc([OH+])cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/q+1 |
| InChIKey | MULVJZGDDYHMNG-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrosinyl radical cation (CHEBI:32787) has functional parent tyrosine (CHEBI:18186) |
| tyrosinyl radical cation (CHEBI:32787) is a α-amino-acid radical cation (CHEBI:36901) |
| tyrosinyl radical cation (CHEBI:32787) is conjugate acid of tyrosinyl radical (CHEBI:32783) |
| Incoming Relation(s) |
| D-tyrosinyl radical cation (CHEBI:32776) is a tyrosinyl radical cation (CHEBI:32787) |
| L-tyrosinyl radical cation (CHEBI:32763) is a tyrosinyl radical cation (CHEBI:32787) |
| tyrosinyl radical (CHEBI:32783) is conjugate base of tyrosinyl radical cation (CHEBI:32787) |
| tyrosinyl radical cation residue (CHEBI:32792) is substituent group from tyrosinyl radical cation (CHEBI:32787) |
| IUPAC Name |
|---|
| [4-(2-amino-2-carboxyethyl)phenyl]oxidaniumyl |
| Synonyms | Source |
|---|---|
| tyrosine(•1+) | ChEBI |
| tyrosine cation radical | ChEBI |
| tyrosine radical cation | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8630624 | Beilstein |