EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO4 |
| Net Charge | 0 |
| Average Mass | 223.228 |
| Monoisotopic Mass | 223.08446 |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | CAHKINHBCWCHCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyltyrosine (CHEBI:68561) has functional parent tyrosine (CHEBI:18186) |
| N-acetyltyrosine (CHEBI:68561) has role human urinary metabolite (CHEBI:84087) |
| N-acetyltyrosine (CHEBI:68561) is a N-acetyl-amino acid (CHEBI:21575) |
| N-acetyltyrosine (CHEBI:68561) is a phenols (CHEBI:33853) |
| N-acetyltyrosine (CHEBI:68561) is a tyrosine derivative (CHEBI:62761) |
| Incoming Relation(s) |
| N-acetyl-L-tyrosine (CHEBI:21563) is a N-acetyltyrosine (CHEBI:68561) |
| IUPAC Names |
|---|
| 2-(acetylamino)-3-(4-hydroxyphenyl)propanoic acid |
| N-acetyltyrosine |
| Synonyms | Source |
|---|---|
| N-acetyl-4-hydroxyphenylalanine | HMDB |
| N-acetyl-DL-tyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000866 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3206104 | Reaxys |
| Citations |
|---|