EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C(O)c1cccc(O)c1O |
| InChI | InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11) |
| InChIKey | GLDQAMYCGOIJDV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybenzoic acid (CHEBI:18026) has functional parent benzoic acid (CHEBI:30746) |
| 2,3-dihydroxybenzoic acid (CHEBI:18026) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,3-dihydroxybenzoic acid (CHEBI:18026) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydroxybenzoic acid (CHEBI:18026) is a dihydroxybenzoic acid (CHEBI:23778) |
| 2,3-dihydroxybenzoic acid (CHEBI:18026) is conjugate acid of 2,3-dihydroxybenzoate (CHEBI:36654) |
| Incoming Relation(s) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| 2,3-dihydroxybenzoic acid 3-O-β-D-xyloside (CHEBI:91166) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| myxochelin B (CHEBI:7061) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| vanchrobactin (CHEBI:157682) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| 2,3-dihydroxybenzoate (CHEBI:36654) is conjugate base of 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| IUPAC Name |
|---|
| 2,3-dihydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2,3-Dihydroxybenzoic acid | KEGG COMPOUND |
| 2,3-dihydroxybenzoic acid | ChEBI |
| 2-pyrocatechuic acid | ChemIDplus |
| 3-hydroxysalicylic acid | ChemIDplus |
| o-pyrocatechuic acid | ChemIDplus |
| catechol-3-carboxylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00196 | KEGG COMPOUND |
| DBH | PDBeChem |
| DB01672 | DrugBank |
| HMDB0000397 | HMDB |
| 2,3-Dihydroxybenzoic_acid | Wikipedia |
| C00002669 | KNApSAcK |
| Citations |
|---|