EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:157682 - vanchrobactin
| Formula | C16H23N5O7 |
| Net Charge | 0 |
| Average Mass | 397.388 |
| Monoisotopic Mass | 397.15975 |
| SMILES | N=C(N)NCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C16H23N5O7/c17-16(18)19-6-2-4-9(14(26)21-10(7-22)15(27)28)20-13(25)8-3-1-5-11(23)12(8)24/h1,3,5,9-10,22-24H,2,4,6-7H2,(H,20,25)(H,21,26)(H,27,28)(H4,17,18,19)/t9-,10+/m1/s1 |
| InChIKey | LXNCWECCTQQXPQ-ZJUUUORDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibrio anguillarum (ncbitaxon:55601) | - | PubMed (23765994) | |
| Vibrio campbellii (ncbitaxon:1088888) | - | PubMed (20521785) | Strain: DS40M4 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanchrobactin (CHEBI:157682) has functional parent D-arginine (CHEBI:15816) |
| vanchrobactin (CHEBI:157682) has functional parent L-serine (CHEBI:17115) |
| vanchrobactin (CHEBI:157682) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| vanchrobactin (CHEBI:157682) has role bacterial metabolite (CHEBI:76969) |
| vanchrobactin (CHEBI:157682) has role marine metabolite (CHEBI:76507) |
| vanchrobactin (CHEBI:157682) has role siderophore (CHEBI:26672) |
| vanchrobactin (CHEBI:157682) is a catechols (CHEBI:33566) |
| vanchrobactin (CHEBI:157682) is a dipeptide (CHEBI:46761) |
| vanchrobactin (CHEBI:157682) is a guanidines (CHEBI:24436) |
| vanchrobactin (CHEBI:157682) is a monocarboxylic acid (CHEBI:25384) |
| vanchrobactin (CHEBI:157682) is a primary alcohol (CHEBI:15734) |
| vanchrobactin (CHEBI:157682) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| N2-(2,3-dihydroxybenzoyl)-D-arginyl-L-serine |
| Synonyms | Source |
|---|---|
| N-[N'-(2,3-dihydroxybenzoyl)-D-arginyl]-L-serine | ChEBI |
| N2-(2,3-dihydroxybenzoyl)-D-Arg-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-21007 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:938160-20-4 | ChEBI |
| Citations |
|---|