EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO6 |
| Net Charge | 0 |
| Average Mass | 241.199 |
| Monoisotopic Mass | 241.05864 |
| SMILES | O=C(NC(CO)C(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C10H11NO6/c12-4-6(10(16)17)11-9(15)5-2-1-3-7(13)8(5)14/h1-3,6,12-14H,4H2,(H,11,15)(H,16,17) |
| InChIKey | VDTYHTVHFIIEIL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) has role siderophore (CHEBI:26672) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) is a benzamides (CHEBI:22702) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) is a phenols (CHEBI:33853) |
| N-(2,3-dihydroxybenzoyl)serine (CHEBI:143101) is a serine derivative (CHEBI:26649) |
| IUPAC Name |
|---|
| N-(2,3-dihydroxybenzoyl)serine |
| Synonyms | Source |
|---|---|
| 2,3-dihydroxybenzoylserine | ChEBI |
| 2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoic acid | ChEBI |
| 2,3-dihydroxy-N-benzoylserine | ChEBI |
| 2-(2,3-dihydroxybenzamido)-3-hydroxypropanoic acid | ChEBI |
| 2-[(2,3-dihydroxyphenyl)formamido]-3-hydroxypropanoic acid | ChEBI |
| 2,3-DHBS | ChEBI |
| Citations |
|---|