EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O6 |
| Net Charge | 0 |
| Average Mass | 403.435 |
| Monoisotopic Mass | 403.17434 |
| SMILES | NC[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C20H25N3O6/c21-11-12(23-20(29)14-7-4-9-16(25)18(14)27)5-1-2-10-22-19(28)13-6-3-8-15(24)17(13)26/h3-4,6-9,12,24-27H,1-2,5,10-11,21H2,(H,22,28)(H,23,29)/t12-/m0/s1 |
| InChIKey | QTARRKFUMCSVOF-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myxochelin B (CHEBI:7061) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| myxochelin B (CHEBI:7061) has role bacterial metabolite (CHEBI:76969) |
| myxochelin B (CHEBI:7061) has role siderophore (CHEBI:26672) |
| myxochelin B (CHEBI:7061) is a benzamides (CHEBI:22702) |
| myxochelin B (CHEBI:7061) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| N-{(2S)-1-amino-6-[(2,3-dihydroxybenzoyl)amino]hexan-2-yl}-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| C12221 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8044180 | Reaxys |
| Citations |
|---|