EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O8 |
| Net Charge | 0 |
| Average Mass | 286.236 |
| Monoisotopic Mass | 286.06887 |
| SMILES | O=C(O)c1cccc(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C12H14O8/c13-6-4-19-12(10(16)9(6)15)20-7-3-1-2-5(8(7)14)11(17)18/h1-3,6,9-10,12-16H,4H2,(H,17,18)/t6-,9+,10-,12+/m1/s1 |
| InChIKey | LRLNKLFTNOIZNI-LYXBDTNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybenzoic acid 3-O-β-D-xyloside (CHEBI:91166) has functional parent 2,3-dihydroxybenzoic acid (CHEBI:18026) |
| 2,3-dihydroxybenzoic acid 3-O-β-D-xyloside (CHEBI:91166) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydroxybenzoic acid 3-O-β-D-xyloside (CHEBI:91166) is a monohydroxybenzoic acid (CHEBI:25389) |
| 2,3-dihydroxybenzoic acid 3-O-β-D-xyloside (CHEBI:91166) is a β-D-xyloside (CHEBI:27926) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(β-D-xylopyranosyloxy)benzoic acid |
| Synonym | Source |
|---|---|
| 2,3-DHBA 3-O-Xyl | ChEBI |
| Citations |
|---|