EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O11 |
| Net Charge | 0 |
| Average Mass | 476.434 |
| Monoisotopic Mass | 476.13186 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OC)cc3o2)ccc1O |
| InChI | InChI=1S/C23H24O11/c1-31-13-5-9(3-4-10(13)25)12-6-11(26)17-15(33-12)7-14(32-2)18(20(17)28)23-22(30)21(29)19(27)16(8-24)34-23/h3-7,16,19,21-25,27-30H,8H2,1-2H3/t16-,19-,21+,22-,23+/m1/s1 |
| InChIKey | JCIFZANQIXZLGH-QJLVSEQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) has role plant metabolite (CHEBI:76924) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) is a dihydroxyflavone (CHEBI:38686) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) is a dimethoxyflavone (CHEBI:23798) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) is a flavone C-glycoside (CHEBI:83280) |
| isoorientin 7,3'-dimethyl ether (CHEBI:131792) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4-oxo-4H-1-benzopyran-6-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 6-beta-D-Glucopyranosyl-4',5-dihydroxy-3',7-dimethoxyflavone | HMDB |
| 7,3'-dimethoxyluteolin-6-C-β-glucoside | ChEBI |
| 7,3'-dimethoxyluteolin-6-C-β-D-glucopyranoside | ChEBI |
| 7,3'-dimethoxyluteolin-6-C-β-D-glucoside | ChEBI |
| 7,3'-Di-O-methylisoorientin | LIPID MAPS |
| isoorientin 3',7-dimethyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 35014437 | ChemSpider |
| C00006142 | KNApSAcK |
| HMDB0037568 | HMDB |
| LMPK12111048 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7003797 | Reaxys |
| CAS:74198-15-5 | KNApSAcK |
| Citations |
|---|