EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C27H30O16/c28-6-15-20(35)23(38)26(43-27-24(39)22(37)19(34)16(7-29)42-27)25(41-15)18-12(33)5-14-17(21(18)36)11(32)4-13(40-14)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2/t15-,16-,19-,20-,22+,23+,24-,25+,26-,27+/m1/s1 |
| InChIKey | QWAZWXOCSOFIPS-FASGCTRLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) | ||
| leaf (BTO:0000713) | PubMed (23849114) | ||
| Passiflora incarnata (ncbitaxon:159425) | - | PubMed (2026709) | |
| Dianthus chinensis (ncbitaxon:118431) | aerial part (BTO:0001658) | PubMed (7764590) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoorientin 2''-O-glucoside (CHEBI:131779) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 2''-O-glucoside (CHEBI:131779) has role plant metabolite (CHEBI:76924) |
| isoorientin 2''-O-glucoside (CHEBI:131779) is a flavone C-glycoside (CHEBI:83280) |
| isoorientin 2''-O-glucoside (CHEBI:131779) is a polyphenol (CHEBI:26195) |
| isoorientin 2''-O-glucoside (CHEBI:131779) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-1-benzopyran-6-yl]-2-O-β-D-glucopyranosyl-D-glucitol |
| Synonyms | Source |
|---|---|
| Isoorientin 2''-O-glucopyranoside | LIPID MAPS |
| Meloside L | KNApSAcK |
| isoorientin 2''-glucoside | ChEBI |
| isoorientin 2''-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12110497 | LIPID MAPS |
| C00006210 | KNApSAcK |
| HMDB0029478 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8101267 | Reaxys |
| CAS:55196-48-0 | KNApSAcK |
| Citations |
|---|