EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | C[C@@H]1OC(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O15/c1-8-19(33)22(36)24(38)27(39-8)42-26-23(37)20(34)16(7-28)41-25(26)18-13(32)6-15-17(21(18)35)12(31)5-14(40-15)9-2-3-10(29)11(30)4-9/h2-6,8,16,19-20,22-30,32-38H,7H2,1H3/t8-,16+,19-,20+,22+,23-,24+,25-,26+,27?/m0/s1 |
| InChIKey | IUYFTHKQEWZTHY-LQQQXCKLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) has functional parent isoorientin (CHEBI:17965) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) has role antifeedant (CHEBI:22583) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) has role plant metabolite (CHEBI:76924) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) is a flavone C-glycoside (CHEBI:83280) |
| isoorientin 2''-O-rhamnoside (CHEBI:28596) is a tetrahydroxyflavone (CHEBI:38684) |
| Incoming Relation(s) |
| 2''-O-α-L-rhamnosylisoorietin (CHEBI:70203) is a isoorientin 2''-O-rhamnoside (CHEBI:28596) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-L-mannopyranosyl)-1-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-6-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| Isoorientin 2''-O-rhamnoside | KEGG COMPOUND |
| rhamnosylisoorientin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03870 | KEGG COMPOUND |
| CPD-9587 | MetaCyc |
| LMPK12110495 | LIPID MAPS |
| C00006208 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8028926 | Reaxys |
| Citations |
|---|