EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O5 |
| Net Charge | 0 |
| Average Mass | 332.311 |
| Monoisotopic Mass | 332.06847 |
| SMILES | O=C(O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,21H,(H,23,24) |
| InChIKey | YKGGGCXBWXHKIZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorescein (acid form) (CHEBI:172923) has role fluorescent dye (CHEBI:51121) |
| fluorescein (acid form) (CHEBI:172923) has role radioopaque medium (CHEBI:37338) |
| fluorescein (acid form) (CHEBI:172923) is a benzoic acids (CHEBI:22723) |
| fluorescein (acid form) (CHEBI:172923) is a cyclic ketone (CHEBI:3992) |
| fluorescein (acid form) (CHEBI:172923) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| fluorescein (acid form) (CHEBI:172923) is a organic heterotricyclic compound (CHEBI:26979) |
| fluorescein (acid form) (CHEBI:172923) is a phenols (CHEBI:33853) |
| fluorescein (acid form) (CHEBI:172923) is a xanthene dye (CHEBI:37929) |
| Incoming Relation(s) |
| 2',4',5',7'-tetrabromo-2,3,4,5-tetrachlorofluorescein (CHEBI:87193) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 2',7'-bis-(2-carboxyethyl)-5-carboxyfluorescein (CHEBI:52690) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 2',7'-bis-(2-carboxyethyl)-6-carboxyfluorescein (CHEBI:52691) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 2',7'-bis-(2-carboxyethyl)carboxyfluorescein (CHEBI:52689) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 5-carboxynaphthofluorescein (CHEBI:52708) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 6-O-(carboxymethyl)fluorescein ethyl ester (CHEBI:72440) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 6-carboxynaphthofluorescein (CHEBI:52709) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 7-glycidyloxy-9-(2-glycidyloxycarbonylphenyl)-2-xanthone (CHEBI:137560) has functional parent fluorescein (acid form) (CHEBI:172923) |
| carboxynaphthofluorescein (CHEBI:52707) has functional parent fluorescein (acid form) (CHEBI:172923) |
| erythrosin (CHEBI:87117) has functional parent fluorescein (acid form) (CHEBI:172923) |
| fluorescein (lactone form) (CHEBI:31624) has functional parent fluorescein (acid form) (CHEBI:172923) |
| oregon green 488 (CHEBI:44777) has functional parent fluorescein (acid form) (CHEBI:172923) |
| IUPAC Name |
|---|
| 2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-(3-hydroxy-6-oxo-xanthen-9-yl)benzoic acid | PDBeChem |
| 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid | ChEBI |
| fluorescein acid | ChEBI |
| fluorescein (free acid) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3266 | ChemSpider |
| FLU | PDBeChem |
| Fluorescein | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:518-45-6 | ChemIDplus |
| Citations |
|---|