EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H10I4O5 |
| Net Charge | 0 |
| Average Mass | 837.911 |
| Monoisotopic Mass | 837.67072 |
| SMILES | O=C1C(I)=CC2=C(c3ccccc3C(=O)O)C3C=C(I)C(O)=C(I)C3OC2=C1I |
| InChI | InChI=1S/C20H10I4O5/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6,9,18,25H,(H,27,28) |
| InChIKey | WTOSNONTQZJEBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythrosin (CHEBI:87117) has functional parent fluorescein (acid form) (CHEBI:172923) |
| erythrosin (CHEBI:87117) has role fluorescent dye (CHEBI:51121) |
| erythrosin (CHEBI:87117) is a benzoic acids (CHEBI:22723) |
| erythrosin (CHEBI:87117) is a organoiodine compound (CHEBI:37142) |
| erythrosin (CHEBI:87117) is a phenols (CHEBI:33853) |
| erythrosin (CHEBI:87117) is a xanthene dye (CHEBI:37929) |
| erythrosin (CHEBI:87117) is conjugate acid of erythrosin(2−) (CHEBI:87118) |
| Incoming Relation(s) |
| erythrosin(2−) (CHEBI:87118) is conjugate base of erythrosin (CHEBI:87117) |
| IUPAC Name |
|---|
| 2-(2,4,5,7-tetraiodo-6-oxido-3-oxo-8a,10a-dihydro-3H-xanthen-9-yl)benzoic acid |
| Synonyms | Source |
|---|---|
| erythrosin B free acid | ChEBI |
| acid red 51 (free acid form) | ChEBI |
| Erythrosin(E) | ChemIDplus |
| 2,4,5,7-Tetraiodofluorescein | ChemIDplus |
| NSC 4905 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:548-25-4 | ChemIDplus |