EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H10F2O7 |
| Net Charge | 0 |
| Average Mass | 412.300 |
| Monoisotopic Mass | 412.03946 |
| SMILES | O=C(O)c1ccc(-c2c3cc(F)c(=O)cc-3oc3cc(O)c(F)cc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H10F2O7/c22-13-4-11-17(6-15(13)24)30-18-7-16(25)14(23)5-12(18)19(11)9-2-1-8(20(26)27)3-10(9)21(28)29/h1-7,24H,(H,26,27)(H,28,29) |
| InChIKey | BRJCLSQFZSHLRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oregon green 488 (CHEBI:44777) has functional parent fluorescein (acid form) (CHEBI:172923) |
| oregon green 488 (CHEBI:44777) has role epitope (CHEBI:53000) |
| oregon green 488 (CHEBI:44777) has role fluorochrome (CHEBI:51217) |
| oregon green 488 (CHEBI:44777) is a xanthene dye (CHEBI:37929) |
| IUPAC Name |
|---|
| 4-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzene-1,3-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 4-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)isophthalic acid | IUPAC |
| 4-(2,7-DIFLUORO-6-HYDROXY-3-OXO-3H-XANTHEN-9-YL)ISOPHTHALIC ACID | PDBeChem |
| oregon green 488 carboxylate | DrugBank |
| oregon green 488 carboxylic acid | ChEBI |
| Citations |
|---|