EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18O7 |
| Net Charge | 0 |
| Average Mass | 418.401 |
| Monoisotopic Mass | 418.10525 |
| SMILES | CCOC(=O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(OCC(=O)O)ccc12 |
| InChI | InChI=1S/C24H18O7/c1-2-29-24(28)17-6-4-3-5-16(17)23-18-9-7-14(25)11-20(18)31-21-12-15(8-10-19(21)23)30-13-22(26)27/h3-12H,2,13H2,1H3,(H,26,27) |
| InChIKey | PUGOKYOQJONOGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-(carboxymethyl)fluorescein ethyl ester (CHEBI:72440) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 6-O-(carboxymethyl)fluorescein ethyl ester (CHEBI:72440) has role fluorescent probe (CHEBI:39442) |
| 6-O-(carboxymethyl)fluorescein ethyl ester (CHEBI:72440) is a dicarboxylic acid monoester (CHEBI:36244) |
| 6-O-(carboxymethyl)fluorescein ethyl ester (CHEBI:72440) is a ethyl ester (CHEBI:23990) |
| IUPAC Name |
|---|
| ({9-[2-(ethoxycarbonyl)phenyl]-3-oxo-3H-xanthen-6-yl}oxy)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| EP1749870 | Patent |
| US2008275215 | Patent |
| Citations |
|---|