EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H20O11 |
| Net Charge | 0 |
| Average Mass | 520.446 |
| Monoisotopic Mass | 520.10056 |
| SMILES | O=C(O)CCc1cc2c(-c3ccc(C(=O)O)cc3C(=O)O)c3cc(CCC(=O)O)c(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C27H20O11/c28-19-10-21-17(7-12(19)2-5-23(30)31)25(15-4-1-14(26(34)35)9-16(15)27(36)37)18-8-13(3-6-24(32)33)20(29)11-22(18)38-21/h1,4,7-11,28H,2-3,5-6H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | WPJWCCYXUYHUIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',7'-bis-(2-carboxyethyl)-5-carboxyfluorescein (CHEBI:52690) has functional parent fluorescein (acid form) (CHEBI:172923) |
| 2',7'-bis-(2-carboxyethyl)-5-carboxyfluorescein (CHEBI:52690) has role fluorochrome (CHEBI:51217) |
| 2',7'-bis-(2-carboxyethyl)-5-carboxyfluorescein (CHEBI:52690) is a 2',7'-bis-(2-carboxyethyl)carboxyfluorescein (CHEBI:52689) |
| IUPAC Name |
|---|
| 4-[2,7-bis(2-carboxyethyl)-6-hydroxy-3-oxo-3H-xanthen-9-yl]benzene-1,3-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8815638 | Reaxys |