EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| InChIKey | VGEREEWJJVICBM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phloretin (CHEBI:17276) has functional parent dihydrochalcone (CHEBI:71231) |
| phloretin (CHEBI:17276) has role antineoplastic agent (CHEBI:35610) |
| phloretin (CHEBI:17276) has role plant metabolite (CHEBI:76924) |
| phloretin (CHEBI:17276) is a dihydrochalcones (CHEBI:71230) |
| Incoming Relation(s) |
| 3-hydroxyphloretin 2'-O-xylosylglucoside (CHEBI:88354) has functional parent phloretin (CHEBI:17276) |
| asebogenin (CHEBI:2871) has functional parent phloretin (CHEBI:17276) |
| glycyphyllin (CHEBI:27400) has functional parent phloretin (CHEBI:17276) |
| phlorizin (CHEBI:8113) has functional parent phloretin (CHEBI:17276) |
| trilobatin (CHEBI:145829) has functional parent phloretin (CHEBI:17276) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| Phloretin | KEGG COMPOUND |
| 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone | ChEBI |
| UniProt Name | Source |
|---|---|
| phloretin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00774 | KEGG COMPOUND |
| C00774 | KEGG COMPOUND |
| G50 | PDBeChem |
| LMPK12120525 | LIPID MAPS |
| DB07810 | DrugBank |
| PHLORETIN | MetaCyc |
| Phloretin | Wikipedia |
| HMDB0003306 | HMDB |
| CN103230408 | Patent |
| CN102701938 | Patent |
| C00007936 | KNApSAcK |
| LSM-6221 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1887240 | Reaxys |
| CAS:60-82-2 | KEGG COMPOUND |
| CAS:60-82-2 | ChemIDplus |
| Citations |
|---|