EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O5 |
| Net Charge | 0 |
| Average Mass | 288.299 |
| Monoisotopic Mass | 288.09977 |
| SMILES | COc1cc(O)c(C(=O)CCc2ccc(O)cc2)c(O)c1 |
| InChI | InChI=1S/C16H16O5/c1-21-12-8-14(19)16(15(20)9-12)13(18)7-4-10-2-5-11(17)6-3-10/h2-3,5-6,8-9,17,19-20H,4,7H2,1H3 |
| InChIKey | UPXIBKPHJYQSGP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pieris japonica (ncbitaxon:317406) | leaf (BTO:0000713) | PubMed (15787442) | |
| Piper longicaudatum (ncbitaxon:538297) | |||
| twig (BTO:0001411) | PubMed (11301876) | ||
| leaf (BTO:0000713) | PubMed (11301876) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asebogenin (CHEBI:2871) has functional parent phloretin (CHEBI:17276) |
| asebogenin (CHEBI:2871) has role plant metabolite (CHEBI:76924) |
| asebogenin (CHEBI:2871) is a dihydrochalcones (CHEBI:71230) |
| IUPAC Name |
|---|
| 1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-hydroxyphenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| 2',6',4-trihydroxy-4'-methoxy-dihydrochalcone | ChEBI |
| Phloretin 4'-methyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000940 | KNApSAcK |
| C09471 | KEGG COMPOUND |
| LMPK12120545 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3399222 | Reaxys |
| CAS:520-42-3 | KEGG COMPOUND |
| Citations |
|---|