EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O |
| Net Charge | 0 |
| Average Mass | 210.276 |
| Monoisotopic Mass | 210.10447 |
| SMILES | O=C(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | QGGZBXOADPVUPN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrochalcone (CHEBI:71231) has role plant metabolite (CHEBI:76924) |
| dihydrochalcone (CHEBI:71231) is a dihydrochalcones (CHEBI:71230) |
| Incoming Relation(s) |
| 2',4',6'-trihydroxy-3'-formyldihydrochalcone (CHEBI:28150) has functional parent dihydrochalcone (CHEBI:71231) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) has functional parent dihydrochalcone (CHEBI:71231) |
| davidigenin (CHEBI:27655) has functional parent dihydrochalcone (CHEBI:71231) |
| phloretin (CHEBI:17276) has functional parent dihydrochalcone (CHEBI:71231) |
| IUPAC Name |
|---|
| 1,3-diphenylpropan-1-one |
| Synonyms | Source |
|---|---|
| benzyl acetophenone | ChEBI |
| β-phenylpropiophenone | ChEBI |
| 1,3-Diphenyl-1-oxopropane | ChemIDplus |
| Hydrochalcone | ChemIDplus |
| Hydrocinnamophenone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Dihydrochalcone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1910661 | Reaxys |
| CAS:1083-30-3 | ChemIDplus |