EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O10 |
| Net Charge | 0 |
| Average Mass | 436.413 |
| Monoisotopic Mass | 436.13695 |
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-24,26-29H,3,6,9H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | IOUVKUPGCMBWBT-QNDFHXLGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phlorizin (CHEBI:8113) has functional parent phloretin (CHEBI:17276) |
| phlorizin (CHEBI:8113) has role antioxidant (CHEBI:22586) |
| phlorizin (CHEBI:8113) has role plant metabolite (CHEBI:76924) |
| phlorizin (CHEBI:8113) is a aryl β-D-glucoside (CHEBI:28749) |
| phlorizin (CHEBI:8113) is a dihydrochalcones (CHEBI:71230) |
| phlorizin (CHEBI:8113) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-[3-(4-hydroxyphenyl)propanoyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Phlorizin | KEGG COMPOUND |
| Phlorhizin | KEGG COMPOUND |
| Phloridzin | KEGG COMPOUND |
| Phloretin 2'-glucoside | ChemIDplus |
| Phlorizoside | ChemIDplus |
| Floridzin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| phlorizin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01604 | KEGG COMPOUND |
| Phlorizin | Wikipedia |
| CPD-12447 | MetaCyc |
| HMDB0036634 | HMDB |
| CN103214530 | Patent |
| CN102697895 | Patent |
| C00000990 | KNApSAcK |
| LSM-25654 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:66621 | Reaxys |
| CAS:60-81-1 | KEGG COMPOUND |
| CAS:60-81-1 | ChemIDplus |
| Citations |
|---|