EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O10 |
| Net Charge | 0 |
| Average Mass | 436.413 |
| Monoisotopic Mass | 436.13695 |
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-12-7-14(25)17(15(26)8-12)13(24)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-23,25-29H,3,6,9H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GSTCPEBQYSOEHV-QNDFHXLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lithocarpus litseifolius (ncbitaxon:425828) | leaf (BTO:0000713) | DOI (10.1080/00021369.1982.10865357) | |
| Lithocarpus polystachyus (IPNI:358942-1) | leaf (BTO:0000713) | PubMed (25053100) | |
| Malus trilobata (ncbitaxon:106570) | leaf (BTO:0000713) | DOI (10.1039/JR9610004133) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trilobatin (CHEBI:145829) has functional parent phloretin (CHEBI:17276) |
| trilobatin (CHEBI:145829) has role anti-inflammatory agent (CHEBI:67079) |
| trilobatin (CHEBI:145829) has role antioxidant (CHEBI:22586) |
| trilobatin (CHEBI:145829) has role plant metabolite (CHEBI:76924) |
| trilobatin (CHEBI:145829) has role sweetening agent (CHEBI:50505) |
| trilobatin (CHEBI:145829) is a aryl β-D-glucoside (CHEBI:28749) |
| trilobatin (CHEBI:145829) is a dihydrochalcones (CHEBI:71230) |
| trilobatin (CHEBI:145829) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4-[3-(4-hydroxyphenyl)propanoyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 1-(4-(β-D-glucopyranosyloxy)-2,6-dihydroxyphenyl)-3-(4-hydroxyphenyl)-1-propanone | ChemIDplus |
| p-phloridzin | ChemIDplus |
| p-phlorizin | ChemIDplus |
| phloretin-4'-β-D-glucopyranoside | ChEBI |
| phloretin-4'-β-D-glucoside | ChEBI |
| UniProt Name | Source |
|---|---|
| trilobatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00007991 | KNApSAcK |
| FDB016580 | FooDB |
| HMDB0037505 | HMDB |
| LMPK12120518 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:4192-90-9 | ChemIDplus |
| Citations |
|---|