EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O3S2 |
| Net Charge | 0 |
| Average Mass | 280.330 |
| Monoisotopic Mass | 279.99763 |
| SMILES | [H][C@]1(C(=O)O)CSC(c2nc3ccc(O)cc3s2)=N1 |
| InChI | InChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | BJGNCJDXODQBOB-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Photinus luciferin (CHEBI:17165) has role luciferin (CHEBI:25078) |
| Photinus luciferin (CHEBI:17165) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| Photinus luciferin (CHEBI:17165) is a benzothiazoles (CHEBI:37947) |
| Photinus luciferin (CHEBI:17165) is a imidothioate (CHEBI:83991) |
| Photinus luciferin (CHEBI:17165) is conjugate acid of Photinus luciferin(1−) (CHEBI:58038) |
| Photinus luciferin (CHEBI:17165) is enantiomer of ent-Photinus luciferin (CHEBI:139036) |
| Incoming Relation(s) |
| firefly sulfoluciferin (CHEBI:133462) has functional parent Photinus luciferin (CHEBI:17165) |
| oxidized Photinus luciferin (CHEBI:16792) is a Photinus luciferin (CHEBI:17165) |
| Photinus luciferin(1−) (CHEBI:58038) is conjugate base of Photinus luciferin (CHEBI:17165) |
| ent-Photinus luciferin (CHEBI:139036) is enantiomer of Photinus luciferin (CHEBI:17165) |
| IUPAC Name |
|---|
| (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| firefly luciferin | ChemIDplus |
| Firefly luciferin | KEGG COMPOUND |
| (S)-4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid | ChemIDplus |
| (S)-4,5-dihydro-2-(6-hydroxybenzothiazol-2-yl)thiazole-4-carboxylic acid | ChemIDplus |
| Photinus luciferin | KEGG COMPOUND |
| (S)-4,5-Dihydro-2-(6-hydroxy-1,3-benzothiazol-2-yl)thiazole-4-carboxylic acid | KEGG COMPOUND |