EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O6S3 |
| Net Charge | 0 |
| Average Mass | 360.394 |
| Monoisotopic Mass | 359.95445 |
| SMILES | O=C(O)[C@H]1CSC(c2nc3ccc(OS(=O)(=O)O)cc3s2)=N1 |
| InChI | InChI=1S/C11H8N2O6S3/c14-11(15)7-4-20-9(13-7)10-12-6-2-1-5(3-8(6)21-10)19-22(16,17)18/h1-3,7H,4H2,(H,14,15)(H,16,17,18)/t7-/m1/s1 |
| InChIKey | LPKFAQWRYNJJRB-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photinus pyralis (ncbitaxon:7054) | - | PubMed (27227579) | |
| Pyractomena sp. (ncbitaxon:95015) | - | PubMed (27227579) | |
| Photuris sp. (ncbitaxon:4171) | - | PubMed (27227579) | |
| Ellychnia corrusca (ncbitaxon:94999) | - | PubMed (27227579) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| firefly sulfoluciferin (CHEBI:133462) has functional parent Photinus luciferin (CHEBI:17165) |
| firefly sulfoluciferin (CHEBI:133462) has role animal metabolite (CHEBI:75767) |
| firefly sulfoluciferin (CHEBI:133462) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| firefly sulfoluciferin (CHEBI:133462) is a aryl sulfate (CHEBI:37919) |
| firefly sulfoluciferin (CHEBI:133462) is a benzothiazoles (CHEBI:37947) |
| firefly sulfoluciferin (CHEBI:133462) is a imidothioate (CHEBI:83991) |
| firefly sulfoluciferin (CHEBI:133462) is conjugate acid of firefly D-sulfoluciferin(2−) (CHEBI:143025) |
| Incoming Relation(s) |
| firefly D-sulfoluciferin(2−) (CHEBI:143025) is conjugate base of firefly sulfoluciferin (CHEBI:133462) |
| IUPAC Name |
|---|
| (4S)-2-[6-(sulfooxy)-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| (6-sulfooxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid | ChEBI |
| Photinus luciferin O-sulfate | ChEBI |
| D-luciferin O-sulfate | ChEBI |
| Photinus luciferin sulfate | ChEBI |
| firefly luciferin sulfate | ChEBI |
| firefly luciferin O-sulfate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13866155 | Reaxys |
| Citations |
|---|