EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O3S2 |
| Net Charge | 0 |
| Average Mass | 280.330 |
| Monoisotopic Mass | 279.99763 |
| SMILES | O=C(O)[C@@H]1CSC(c2nc3ccc(O)cc3s2)=N1 |
| InChI | InChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | BJGNCJDXODQBOB-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Luciola lateralis (ncbitaxon:7052) | - | PubMed (24391868) |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-Photinus luciferin (CHEBI:139036) has role animal metabolite (CHEBI:75767) |
| ent-Photinus luciferin (CHEBI:139036) has role luciferin (CHEBI:25078) |
| ent-Photinus luciferin (CHEBI:139036) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| ent-Photinus luciferin (CHEBI:139036) is a benzothiazoles (CHEBI:37947) |
| ent-Photinus luciferin (CHEBI:139036) is a imidothioate (CHEBI:83991) |
| ent-Photinus luciferin (CHEBI:139036) is conjugate acid of ent-Photinus luciferin(1−) (CHEBI:138329) |
| ent-Photinus luciferin (CHEBI:139036) is enantiomer of Photinus luciferin (CHEBI:17165) |
| Incoming Relation(s) |
| L-firefly luciferyl-CoA (CHEBI:139035) has functional parent ent-Photinus luciferin (CHEBI:139036) |
| ent-Photinus luciferin(1−) (CHEBI:138329) is conjugate base of ent-Photinus luciferin (CHEBI:139036) |
| Photinus luciferin (CHEBI:17165) is enantiomer of ent-Photinus luciferin (CHEBI:139036) |
| IUPAC Name |
|---|
| (4R)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| ent-firefly luciferin | ChEBI |
| L-Photinus luciferin | MetaCyc |
| L-firefly luciferin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-20206 | MetaCyc |
| WO2006070775 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4196732 | Reaxys |
| Citations |
|---|