EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7N2O3S2 |
| Net Charge | -1 |
| Average Mass | 279.322 |
| Monoisotopic Mass | 278.99036 |
| SMILES | [H][C@]1(C(=O)[O-])CSC(c2nc3ccc(O)cc3s2)=N1 |
| InChI | InChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/p-1/t7-/m1/s1 |
| InChIKey | BJGNCJDXODQBOB-SSDOTTSWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Photinus luciferin(1−) (CHEBI:58038) is a monocarboxylic acid anion (CHEBI:35757) |
| Photinus luciferin(1−) (CHEBI:58038) is conjugate base of Photinus luciferin (CHEBI:17165) |
| Photinus luciferin(1−) (CHEBI:58038) is enantiomer of ent-Photinus luciferin(1−) (CHEBI:138329) |
| Incoming Relation(s) |
| Photinus luciferin (CHEBI:17165) is conjugate acid of Photinus luciferin(1−) (CHEBI:58038) |
| ent-Photinus luciferin(1−) (CHEBI:138329) is enantiomer of Photinus luciferin(1−) (CHEBI:58038) |
| IUPAC Name |
|---|
| (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| Synonyms | Source |
|---|---|
| Photinus luciferin carboxylate | ChEBI |
| Photinus luciferin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| firefly D-luciferin | UniProt |