EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16792 - oxidized Photinus luciferin
| Formula | C10H6N2O2S2 |
| Net Charge | 0 |
| Average Mass | 250.304 |
| Monoisotopic Mass | 249.98707 |
| SMILES | O=C1CSC(c2nc3ccc(O)cc3s2)=N1 |
| InChI | InChI=1S/C10H6N2O2S2/c13-5-1-2-6-7(3-5)16-10(11-6)9-12-8(14)4-15-9/h1-3,13H,4H2 |
| InChIKey | JJVOROULKOMTKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxidized Photinus luciferin (CHEBI:16792) has role oxidized luciferins (CHEBI:25747) |
| oxidized Photinus luciferin (CHEBI:16792) is a Photinus luciferin (CHEBI:17165) |
| oxidized Photinus luciferin (CHEBI:16792) is conjugate acid of oxidized Photinus luciferin(1−) (CHEBI:57900) |
| Incoming Relation(s) |
| oxidized Photinus luciferin(1−) (CHEBI:57900) is conjugate base of oxidized Photinus luciferin (CHEBI:16792) |
| IUPAC Name |
|---|
| 2-(6-hydroxy-1,3-benzothiazol-2-yl)-1,3-thiazol-4(5H)-one |
| Synonym | Source |
|---|---|
| Oxidized Photinus luciferin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| firefly oxyluciferin | UniProt |