EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10 |
| Net Charge | 0 |
| Average Mass | 154.212 |
| Monoisotopic Mass | 154.07825 |
| SMILES | c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ZUOUZKKEUPVFJK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenyl (CHEBI:17097) has role antifungal agrochemical (CHEBI:86328) |
| biphenyl (CHEBI:17097) has role antimicrobial food preservative (CHEBI:65256) |
| biphenyl (CHEBI:17097) is a aromatic fungicide (CHEBI:87034) |
| biphenyl (CHEBI:17097) is a benzenes (CHEBI:22712) |
| biphenyl (CHEBI:17097) is a biphenyls (CHEBI:22888) |
| Incoming Relation(s) |
| N-({4'-[(1-benzofuran-2-ylcarbonyl)amino]biphenyl-4-yl}sulfonyl)-L-valine (CHEBI:39489) has parent hydride biphenyl (CHEBI:17097) |
| bifenazate (CHEBI:38660) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-2-ol (CHEBI:17043) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-4-amine (CHEBI:1784) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-4,4'-diol (CHEBI:34367) has parent hydride biphenyl (CHEBI:17097) |
| diphenic acid (CHEBI:23837) has parent hydride biphenyl (CHEBI:17097) |
| flurbiprofen (CHEBI:5130) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-4-yl group (CHEBI:35447) is substituent group from biphenyl (CHEBI:17097) |
| IUPAC Name |
|---|
| 1,1'-biphenyl |
| Synonyms | Source |
|---|---|
| 1,1'-Biphenyl | KEGG COMPOUND |
| 1,1'-Diphenyl | KEGG COMPOUND |
| Biphenyl | KEGG COMPOUND |
| E230 | ChEBI |
| Phenylbenzene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| biphenyl | UniProt |
| Citations |
|---|