EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O |
| Net Charge | 0 |
| Average Mass | 170.211 |
| Monoisotopic Mass | 170.07316 |
| SMILES | Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |
| InChIKey | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. environmental food contaminant Any unwanted chemical in food. The term includes agrochemicals and industrial chemicals that may contaminate foodstuffs during their production, transportation or storage. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenyl-2-ol (CHEBI:17043) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-2-ol (CHEBI:17043) has role antifungal agrochemical (CHEBI:86328) |
| biphenyl-2-ol (CHEBI:17043) has role environmental food contaminant (CHEBI:78299) |
| biphenyl-2-ol (CHEBI:17043) is a hydroxybiphenyls (CHEBI:24681) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-2-ol |
| Synonyms | Source |
|---|---|
| 2-Hydroxybiphenyl | KEGG COMPOUND |
| 2-Biphenylol | KEGG COMPOUND |
| 2-Phenylphenol | KEGG COMPOUND |
| o-phenylphenol | ChemIDplus |
| o-diphenylol | ChemIDplus |
| o-hydroxydiphenyl | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| biphenyl-2-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02499 | KEGG COMPOUND |
| c0269 | UM-BBD |
| HMDB0032582 | HMDB |
| D08367 | KEGG DRUG |
| Biphenyl-2-ol | Wikipedia |
| 4768 | DrugCentral |
| 1340 | PPDB |
| Citations |
|---|