EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O4 |
| Net Charge | 0 |
| Average Mass | 242.230 |
| Monoisotopic Mass | 242.05791 |
| SMILES | O=C(O)c1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenic acid (CHEBI:23837) has parent hydride biphenyl (CHEBI:17097) |
| diphenic acid (CHEBI:23837) is a dicarboxylic acid (CHEBI:35692) |
| diphenic acid (CHEBI:23837) is conjugate acid of diphenate(1−) (CHEBI:19283) |
| Incoming Relation(s) |
| diphenate(1−) (CHEBI:19283) is conjugate base of diphenic acid (CHEBI:23837) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-2,2'-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 2,2'-biphenyldicarboxylic acid | NIST Chemistry WebBook |
| diphenic acid | ChemIDplus |
| 2,2'-diphenic acid | NIST Chemistry WebBook |
| biphenyl-2,2'-dicarboxylic acid | NIST Chemistry WebBook |
| 2,2'-bibenzoic acid | NIST Chemistry WebBook |
| 2,2'-dicarboxybiphenyl | ChemIDplus |