EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N |
| Net Charge | 0 |
| Average Mass | 169.227 |
| Monoisotopic Mass | 169.08915 |
| SMILES | Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2 |
| InChIKey | DMVOXQPQNTYEKQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenyl-4-amine (CHEBI:1784) has parent hydride biphenyl (CHEBI:17097) |
| biphenyl-4-amine (CHEBI:1784) has role carcinogenic agent (CHEBI:50903) |
| biphenyl-4-amine (CHEBI:1784) is a aminobiphenyl (CHEBI:22496) |
| Incoming Relation(s) |
| N-acetoxy-1,1'-biphenyl-4-amine (CHEBI:16395) has functional parent biphenyl-4-amine (CHEBI:1784) |
| N-hydroxy-4-acetylaminobiphenyl (CHEBI:16434) has functional parent biphenyl-4-amine (CHEBI:1784) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) has functional parent biphenyl-4-amine (CHEBI:1784) |
| N-hydroxy-4-aminobiphenyl O-glucuronide (CHEBI:32649) has functional parent biphenyl-4-amine (CHEBI:1784) |
| N-hydroxy-4-aminobiphenyl O-sulfate (CHEBI:32701) has functional parent biphenyl-4-amine (CHEBI:1784) |
| 4'-aminobiphenyl-4-ol (CHEBI:35435) has functional parent biphenyl-4-amine (CHEBI:1784) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-4-amine |
| Synonyms | Source |
|---|---|
| 4-Aminobiphenyl | KEGG COMPOUND |
| p-biphenylamine | ChemIDplus |
| 4-amino-1,1'-biphenyl | ChemIDplus |
| 4-aminodiphenyl | ChemIDplus |
| 4-biphenylamine | ChemIDplus |
| biphenyl-4-ylamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C10998 | KEGG COMPOUND |
| HMDB0013195 | HMDB |
| 4-Aminobiphenyl | Wikipedia |
| Citations |
|---|