EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)CCC(O)C(=O)O |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | HWXBTNAVRSUOJR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyglutaric acid (CHEBI:17084) has functional parent glutaric acid (CHEBI:17859) |
| 2-hydroxyglutaric acid (CHEBI:17084) has role metabolite (CHEBI:25212) |
| 2-hydroxyglutaric acid (CHEBI:17084) has role mouse metabolite (CHEBI:75771) |
| 2-hydroxyglutaric acid (CHEBI:17084) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| 2-hydroxyglutaric acid (CHEBI:17084) is a dicarboxylic fatty acid (CHEBI:189840) |
| 2-hydroxyglutaric acid (CHEBI:17084) is conjugate acid of 2-hydroxyglutarate (CHEBI:132941) |
| 2-hydroxyglutaric acid (CHEBI:17084) is conjugate acid of 2-hydroxyglutarate(1−) (CHEBI:36149) |
| Incoming Relation(s) |
| 2-hydroxyglutaryl-CoA (CHEBI:28578) has functional parent 2-hydroxyglutaric acid (CHEBI:17084) |
| diethyl 2-hydroxypentanedioate (CHEBI:87295) has functional parent 2-hydroxyglutaric acid (CHEBI:17084) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is a 2-hydroxyglutaric acid (CHEBI:17084) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is a 2-hydroxyglutaric acid (CHEBI:17084) |
| 2-hydroxyglutarate (CHEBI:132941) is conjugate base of 2-hydroxyglutaric acid (CHEBI:17084) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is conjugate base of 2-hydroxyglutaric acid (CHEBI:17084) |
| IUPAC Name |
|---|
| 2-hydroxypentanedioic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxyglutaric acid | ChemIDplus |
| α-hydroxyglutaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-HYDROXYGLUTARIC_ACID | MetaCyc |
| Alpha-Hydroxyglutaric_acid | Wikipedia |
| C02630 | KEGG COMPOUND |
| HMDB0059655 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723805 | Reaxys |
| CAS:2889-31-8 | KEGG COMPOUND |
| CAS:2889-31-8 | ChemIDplus |
| Citations |
|---|