EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32797 - (S)-2-hydroxyglutaric acid
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)CC[C@H](O)C(=O)O |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | HWXBTNAVRSUOJR-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is a 2-hydroxyglutaric acid (CHEBI:17084) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is conjugate acid of (S)-2-hydroxyglutarate(2−) (CHEBI:16782) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is enantiomer of (R)-2-hydroxyglutaric acid (CHEBI:32796) |
| Incoming Relation(s) |
| (S)-α-hydroxyglutaric acid-γ-lactone (CHEBI:73677) has functional parent (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| (S)-2-hydroxyglutarate(2−) (CHEBI:16782) is conjugate base of (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is enantiomer of (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| IUPAC Name |
|---|
| (2S)-2-hydroxypentanedioic acid |
| Synonym | Source |
|---|---|
| (S)-2-Hydroxyglutarate | KEGG COMPOUND |